[18O,18O]AMP
Adenosine 5’- ([18O, 18O]-monophosphate)
Download Sdf File

ID: 351.1.1
Molecular formula: C10H13N5O7P-
Instrument: API 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -45 V
Collision energy: -40 eV
Canonical smiles: Nc1ncnc2c1ncn2C1OC(COP(=O)([18O-])[18OH])C(O)C1O
| m/z |
80 |
81 |
83 |
101 |
107 |
134 |
143 |
155 |
197 |
215 |
350 |
| intensity |
1 |
13 |
100 |
47 |
2 |
39 |
3 |
6 |
2 |
3 |
21 |