2'-dCDP
2’deoxycytidine 5′-diphosphate
Download Sdf File

ID: 387.1.1
Molecular formula: C9H14N3O10P2-
Instrument: API 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -30 V
Collision energy: -50 eV
Canonical smiles: Nc1ccn(C2CC(O)C(COP(=O)(O)OP(=O)([O-])O)O2)c(=O)n1
| m/z |
79 |
97 |
159 |
177 |
257 |
275 |
368 |
386 |
| intensity |
100 |
3 |
33 |
2 |
5 |
2 |
5 |
9 |